C29H27N5O6 — CID 5465238
N'-[(E)-1-[6-[(4-ethoxyphenyl)diazenyl]-2-oxochromen-3-yl]ethylideneamino]-N-(3-methoxyphenyl)propanediamide (PubChem CID 5465238) has the molecular formula C29H27N5O6 and a molecular weight of 541.56 g/mol. Its IUPAC name is N'-[(E)-1-[6-[(4-ethoxyphenyl)diazenyl]-2-oxochromen-3-yl]ethylideneamino]-N-(3-methoxyphenyl)propanediamide.
| Compound Name | N'-[(E)-1-[6-[(4-ethoxyphenyl)diazenyl]-2-oxochromen-3-yl]ethylideneamino]-N-(3-methoxyphenyl)propanediamide |
|---|---|
| PubChem CID | 5465238 |
| Molecular Formula | C29H27N5O6 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | N'-[(E)-1-[6-[(4-ethoxyphenyl)diazenyl]-2-oxochromen-3-yl]ethylideneamino]-N-(3-methoxyphenyl)propanediamide |
| SMILES | CCOc1ccc(/N=N/c2ccc3oc(=O)c(/C(C)=N/NC(=O)CC(=O)Nc4cccc(OC)c4)cc3c2)cc1 |
| InChI | InChI=1S/C29H27N5O6/c1-4-39-23-11-8-20(9-12-23)32-33-22-10-13-26-19(14-22)15-25(29(37)40-26)18(2)31-34-28(36)17-27(35)30-21-6-5-7-24(16-21)38-3/h5-16H,4,17H2,1-3H3,(H,30,35)(H,34,36)/b31-18+,33-32+ |
| InChIKey | ZKILCDDOIQBBKU-SOWNPJSHSA-N |
| XLogP | 5.48 |
| TPSA | 143.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|