C25H30ClN3O7S — CID 54654969
2-[(2R,4aR,12aS)-8-[(4-chlorophenyl)sulfonylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 54654969) has the molecular formula C25H30ClN3O7S and a molecular weight of 552.05 g/mol. Its IUPAC name is 2-[(2R,4aR,12aS)-8-[(4-chlorophenyl)sulfonylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[(2R,4aR,12aS)-8-[(4-chlorophenyl)sulfonylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 54654969 |
| Molecular Formula | C25H30ClN3O7S |
| Molecular Weight | 552.05 g/mol |
| Exact Mass | 551.15 |
| IUPAC Name | 2-[(2R,4aR,12aS)-8-[(4-chlorophenyl)sulfonylamino]-5-methyl-6-oxo-2,3,4,4a,12,12a-hexahydropyrano[2,3-c][1,5]benzoxazocin-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C[C@H]1CC[C@@H]2[C@@H](COc3ccc(NS(=O)(=O)c4ccc(Cl)cc4)cc3C(=O)N2C)O1 |
| InChI | InChI=1S/C25H30ClN3O7S/c1-29-21-9-6-18(14-24(30)27-11-12-34-2)36-23(21)15-35-22-10-5-17(13-20(22)25(29)31)28-37(32,33)19-7-3-16(26)4-8-19/h3-5,7-8,10,13,18,21,23,28H,6,9,11-12,14-15H2,1-2H3,(H,27,30)/t18-,21-,23-/m1/s1 |
| InChIKey | LXVVTJIZWLYICJ-JMUQELJHSA-N |
| XLogP | 2.67 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.05 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|