C19H20BrFN2O3S — CID 54664851
[(3aR,4S,9bR)-8-bromo-1-(3-fluorophenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54664851) has the molecular formula C19H20BrFN2O3S and a molecular weight of 455.35 g/mol. Its IUPAC name is [(3aR,4S,9bR)-8-bromo-1-(3-fluorophenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aR,4S,9bR)-8-bromo-1-(3-fluorophenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54664851 |
| Molecular Formula | C19H20BrFN2O3S |
| Molecular Weight | 455.35 g/mol |
| Exact Mass | 454.04 |
| IUPAC Name | [(3aR,4S,9bR)-8-bromo-1-(3-fluorophenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | CN1c2ccc(Br)cc2[C@H]2[C@H](CCN2S(=O)(=O)c2cccc(F)c2)[C@H]1CO |
| InChI | InChI=1S/C19H20BrFN2O3S/c1-22-17-6-5-12(20)9-16(17)19-15(18(22)11-24)7-8-23(19)27(25,26)14-4-2-3-13(21)10-14/h2-6,9-10,15,18-19,24H,7-8,11H2,1H3/t15-,18-,19-/m1/s1 |
| InChIKey | AEUWGDSTZGKNSC-ATZDWAIDSA-N |
| XLogP | 3.15 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |