C25H24F2N2O3S — CID 54665826
[(3aS,4R,9bS)-8-(2-fluorophenyl)-1-(2-fluorophenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol (PubChem CID 54665826) has the molecular formula C25H24F2N2O3S and a molecular weight of 470.54 g/mol. Its IUPAC name is [(3aS,4R,9bS)-8-(2-fluorophenyl)-1-(2-fluorophenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol.
| Compound Name | [(3aS,4R,9bS)-8-(2-fluorophenyl)-1-(2-fluorophenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol |
|---|---|
| PubChem CID | 54665826 |
| Molecular Formula | C25H24F2N2O3S |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [(3aS,4R,9bS)-8-(2-fluorophenyl)-1-(2-fluorophenyl)sulfonyl-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-4-yl]methanol |
| SMILES | CN1c2ccc(-c3ccccc3F)cc2[C@@H]2[C@@H](CCN2S(=O)(=O)c2ccccc2F)[C@@H]1CO |
| InChI | InChI=1S/C25H24F2N2O3S/c1-28-22-11-10-16(17-6-2-3-7-20(17)26)14-19(22)25-18(23(28)15-30)12-13-29(25)33(31,32)24-9-5-4-8-21(24)27/h2-11,14,18,23,25,30H,12-13,15H2,1H3/t18-,23-,25-/m0/s1 |
| InChIKey | IJNNHZXVFHFABC-WYRQLCSISA-N |
| XLogP | 4.19 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |