C25H24FN3O2 — CID 54665721
[(3aS,4R,9bR)-8-(2-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-pyridin-2-ylmethanone (PubChem CID 54665721) has the molecular formula C25H24FN3O2 and a molecular weight of 417.48 g/mol. Its IUPAC name is [(3aS,4R,9bR)-8-(2-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-pyridin-2-ylmethanone.
| Compound Name | [(3aS,4R,9bR)-8-(2-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 54665721 |
| Molecular Formula | C25H24FN3O2 |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | [(3aS,4R,9bR)-8-(2-fluorophenyl)-4-(hydroxymethyl)-5-methyl-3,3a,4,9b-tetrahydro-2H-pyrrolo[3,2-c]quinolin-1-yl]-pyridin-2-ylmethanone |
| SMILES | CN1c2ccc(-c3ccccc3F)cc2[C@H]2[C@H](CCN2C(=O)c2ccccn2)[C@@H]1CO |
| InChI | InChI=1S/C25H24FN3O2/c1-28-22-10-9-16(17-6-2-3-7-20(17)26)14-19(22)24-18(23(28)15-30)11-13-29(24)25(31)21-8-4-5-12-27-21/h2-10,12,14,18,23-24,30H,11,13,15H2,1H3/t18-,23+,24-/m1/s1 |
| InChIKey | PSHIFIWLVUIOGD-PUZWTLIVSA-N |
| XLogP | 3.90 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |