C28H29N3O3S — CID 54667694
[(8R,9S,10R)-6-(benzenesulfonyl)-9-[4-(2-pyridin-2-ylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol (PubChem CID 54667694) has the molecular formula C28H29N3O3S and a molecular weight of 487.63 g/mol. Its IUPAC name is [(8R,9S,10R)-6-(benzenesulfonyl)-9-[4-(2-pyridin-2-ylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol.
| Compound Name | [(8R,9S,10R)-6-(benzenesulfonyl)-9-[4-(2-pyridin-2-ylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
|---|---|
| PubChem CID | 54667694 |
| Molecular Formula | C28H29N3O3S |
| Molecular Weight | 487.63 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | [(8R,9S,10R)-6-(benzenesulfonyl)-9-[4-(2-pyridin-2-ylethynyl)phenyl]-1,6-diazabicyclo[6.2.0]decan-10-yl]methanol |
| SMILES | O=S(=O)(c1ccccc1)N1CCCCN2[C@@H](CO)[C@@H](c3ccc(C#Cc4ccccn4)cc3)[C@@H]2C1 |
| InChI | InChI=1S/C28H29N3O3S/c32-21-27-28(23-14-11-22(12-15-23)13-16-24-8-4-5-17-29-24)26-20-30(18-6-7-19-31(26)27)35(33,34)25-9-2-1-3-10-25/h1-5,8-12,14-15,17,26-28,32H,6-7,18-21H2/t26-,27-,28-/m0/s1 |
| InChIKey | WWVVQGOHNJGCGX-KCHLEUMXSA-N |
| XLogP | 3.09 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|