C24H19N3O11S3 — CID 5468229
4-[[4-[(E)-2-(4-amino-2-sulfophenyl)ethenyl]-3-sulfophenyl]sulfamoyl]-8-hydroxyquinoline-7-carboxylic acid (PubChem CID 5468229) has the molecular formula C24H19N3O11S3 and a molecular weight of 621.63 g/mol. Its IUPAC name is 4-[[4-[(E)-2-(4-amino-2-sulfophenyl)ethenyl]-3-sulfophenyl]sulfamoyl]-8-hydroxyquinoline-7-carboxylic acid.
| Compound Name | 4-[[4-[(E)-2-(4-amino-2-sulfophenyl)ethenyl]-3-sulfophenyl]sulfamoyl]-8-hydroxyquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 5468229 |
| Molecular Formula | C24H19N3O11S3 |
| Molecular Weight | 621.63 g/mol |
| Exact Mass | 621.02 |
| IUPAC Name | 4-[[4-[(E)-2-(4-amino-2-sulfophenyl)ethenyl]-3-sulfophenyl]sulfamoyl]-8-hydroxyquinoline-7-carboxylic acid |
| SMILES | Nc1ccc(/C=C/c2ccc(NS(=O)(=O)c3ccnc4c(O)c(C(=O)O)ccc34)cc2S(=O)(=O)O)c(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C24H19N3O11S3/c25-15-5-3-13(20(11-15)40(33,34)35)1-2-14-4-6-16(12-21(14)41(36,37)38)27-39(31,32)19-9-10-26-22-17(19)7-8-18(23(22)28)24(29)30/h1-12,27-28H,25H2,(H,29,30)(H,33,34,35)(H,36,37,38)/b2-1+ |
| InChIKey | BOXNQLAIPNGWEP-OWOJBTEDSA-N |
| XLogP | 2.69 |
| TPSA | 251.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.63 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|