C24H26N2O5 — CID 54682924
propyl 4-[[4-hydroxy-2-(2-methylpropyl)-1-oxoisoquinoline-3-carbonyl]amino]benzoate (PubChem CID 54682924) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is propyl 4-[[4-hydroxy-2-(2-methylpropyl)-1-oxoisoquinoline-3-carbonyl]amino]benzoate.
| Compound Name | propyl 4-[[4-hydroxy-2-(2-methylpropyl)-1-oxoisoquinoline-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 54682924 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | propyl 4-[[4-hydroxy-2-(2-methylpropyl)-1-oxoisoquinoline-3-carbonyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)c2c(O)c3ccccc3c(=O)n2CC(C)C)cc1 |
| InChI | InChI=1S/C24H26N2O5/c1-4-13-31-24(30)16-9-11-17(12-10-16)25-22(28)20-21(27)18-7-5-6-8-19(18)23(29)26(20)14-15(2)3/h5-12,15,27H,4,13-14H2,1-3H3,(H,25,28) |
| InChIKey | UFRVANLZESLLAW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 97.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |