C22H23NO5 — CID 54684566
ethyl (2E,4E)-5-[4-(dimethylamino)phenyl]-2-[(E)-3-(furan-2-yl)prop-2-enoyl]-3-hydroxypenta-2,4-dienoate (PubChem CID 54684566) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is ethyl (2E,4E)-5-[4-(dimethylamino)phenyl]-2-[(E)-3-(furan-2-yl)prop-2-enoyl]-3-hydroxypenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-[4-(dimethylamino)phenyl]-2-[(E)-3-(furan-2-yl)prop-2-enoyl]-3-hydroxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 54684566 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | ethyl (2E,4E)-5-[4-(dimethylamino)phenyl]-2-[(E)-3-(furan-2-yl)prop-2-enoyl]-3-hydroxypenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C(=O)/C=C/c1ccco1)=C(O)\C=C\c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H23NO5/c1-4-27-22(26)21(20(25)14-12-18-6-5-15-28-18)19(24)13-9-16-7-10-17(11-8-16)23(2)3/h5-15,24H,4H2,1-3H3/b13-9+,14-12+,21-19+ |
| InChIKey | IDZFORRZFASFHU-NKOKBKPTSA-N |
| XLogP | 4.02 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|