C46H48Cl2N4O8S2 — CID 5470055
N,N'-bis[(5E)-2-(4-chlorophenyl)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]decanediamide (PubChem CID 5470055) has the molecular formula C46H48Cl2N4O8S2 and a molecular weight of 919.95 g/mol. Its IUPAC name is N,N'-bis[(5E)-2-(4-chlorophenyl)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]decanediamide.
| Compound Name | N,N'-bis[(5E)-2-(4-chlorophenyl)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]decanediamide |
|---|---|
| PubChem CID | 5470055 |
| Molecular Formula | C46H48Cl2N4O8S2 |
| Molecular Weight | 919.95 g/mol |
| Exact Mass | 918.23 |
| IUPAC Name | N,N'-bis[(5E)-2-(4-chlorophenyl)-5-[(3,4-dimethoxyphenyl)methylidene]-4-oxo-1,3-thiazolidin-3-yl]decanediamide |
| SMILES | COc1ccc(/C=C2/SC(c3ccc(Cl)cc3)N(NC(=O)CCCCCCCCC(=O)NN3C(=O)/C(=C\c4ccc(OC)c(OC)c4)SC3c3ccc(Cl)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C46H48Cl2N4O8S2/c1-57-35-23-13-29(25-37(35)59-3)27-39-43(55)51(45(61-39)31-15-19-33(47)20-16-31)49-41(53)11-9-7-5-6-8-10-12-42(54)50-52-44(56)40(62-46(52)32-17-21-34(48)22-18-32)28-30-14-24-36(58-2)38(26-30)60-4/h13-28,45-46H,5-12H2,1-4H3,(H,49,53)(H,50,54)/b39-27+,40-28+ |
| InChIKey | XCQQBOCAJBMGPS-SDOZPZOWSA-N |
| XLogP | 10.14 |
| TPSA | 135.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.95 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|