C12H23N — CID 547034
N,N,2,7-tetramethylocta-2,7-dien-1-amine (PubChem CID 547034) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is N,N,2,7-tetramethylocta-2,7-dien-1-amine.
| Compound Name | N,N,2,7-tetramethylocta-2,7-dien-1-amine |
|---|---|
| PubChem CID | 547034 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N,N,2,7-tetramethylocta-2,7-dien-1-amine |
| SMILES | C=C(C)CCCC=C(C)CN(C)C |
| InChI | InChI=1S/C12H23N/c1-11(2)8-6-7-9-12(3)10-13(4)5/h9H,1,6-8,10H2,2-5H3 |
| InChIKey | CUUXALMRKKKTSL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|