C32H55N — CID 10343922
(2E,6E)-N-ethyl-3,7,11-trimethyl-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]dodeca-2,6,10-trien-1-amine (PubChem CID 10343922) has the molecular formula C32H55N and a molecular weight of 453.80 g/mol. Its IUPAC name is (2E,6E)-N-ethyl-3,7,11-trimethyl-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]dodeca-2,6,10-trien-1-amine.
| Compound Name | (2E,6E)-N-ethyl-3,7,11-trimethyl-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]dodeca-2,6,10-trien-1-amine |
|---|---|
| PubChem CID | 10343922 |
| Molecular Formula | C32H55N |
| Molecular Weight | 453.80 g/mol |
| Exact Mass | 453.43 |
| IUPAC Name | (2E,6E)-N-ethyl-3,7,11-trimethyl-N-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]dodeca-2,6,10-trien-1-amine |
| SMILES | CCN(C/C=C(\C)CC/C=C(\C)CCC=C(C)C)C/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C32H55N/c1-10-33(25-23-31(8)21-13-19-29(6)17-11-15-27(2)3)26-24-32(9)22-14-20-30(7)18-12-16-28(4)5/h15-16,19-20,23-24H,10-14,17-18,21-22,25-26H2,1-9H3/b29-19+,30-20+,31-23+,32-24+ |
| InChIKey | HFHJHTBFRUVYIO-UDUBSFCQSA-N |
| XLogP | 10.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.80 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|