C18H15N3O2 — CID 54708595
3-(benzylamino)-4-hydroxy-1,9-dihydropyrido[2,3-b]indol-2-one (PubChem CID 54708595) has the molecular formula C18H15N3O2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-(benzylamino)-4-hydroxy-1,9-dihydropyrido[2,3-b]indol-2-one.
| Compound Name | 3-(benzylamino)-4-hydroxy-1,9-dihydropyrido[2,3-b]indol-2-one |
|---|---|
| PubChem CID | 54708595 |
| Molecular Formula | C18H15N3O2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 3-(benzylamino)-4-hydroxy-1,9-dihydropyrido[2,3-b]indol-2-one |
| SMILES | O=c1[nH]c2[nH]c3ccccc3c2c(O)c1NCc1ccccc1 |
| InChI | InChI=1S/C18H15N3O2/c22-16-14-12-8-4-5-9-13(12)20-17(14)21-18(23)15(16)19-10-11-6-2-1-3-7-11/h1-9,19H,10H2,(H3,20,21,22,23) |
| InChIKey | LNZKDINTCLHQDS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |