C19H18ClN3 — CID 51041251
N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine chloride (PubChem CID 51041251) has the molecular formula C19H18ClN3 and a molecular weight of 323.83 g/mol. Its IUPAC name is N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine chloride.
| Compound Name | N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine chloride |
|---|---|
| PubChem CID | 51041251 |
| Molecular Formula | C19H18ClN3 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-benzyl-2-methyl-9H-pyrido[3,4-b]indol-2-ium-3-amine chloride |
| SMILES | C[n+]1cc2[nH]c3ccccc3c2cc1NCc1ccccc1.[Cl-] |
| InChI | InChI=1S/C19H17N3.ClH/c1-22-13-18-16(15-9-5-6-10-17(15)21-18)11-19(22)20-12-14-7-3-2-4-8-14;/h2-11,13H,12H2,1H3,(H,20,21);1H |
| InChIKey | MBHDDEUEPKYWNC-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 31.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|