C32H22ClN5O6S2 — CID 5472210
3-chloro-4-methoxy-N-[4-[2-[(4Z)-4-[(2-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-1,3-thiazol-4-yl]phenyl]benzenesulfonamide (PubChem CID 5472210) has the molecular formula C32H22ClN5O6S2 and a molecular weight of 672.14 g/mol. Its IUPAC name is 3-chloro-4-methoxy-N-[4-[2-[(4Z)-4-[(2-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-1,3-thiazol-4-yl]phenyl]benzenesulfonamide.
| Compound Name | 3-chloro-4-methoxy-N-[4-[2-[(4Z)-4-[(2-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-1,3-thiazol-4-yl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 5472210 |
| Molecular Formula | C32H22ClN5O6S2 |
| Molecular Weight | 672.14 g/mol |
| Exact Mass | 671.07 |
| IUPAC Name | 3-chloro-4-methoxy-N-[4-[2-[(4Z)-4-[(2-nitrophenyl)methylidene]-5-oxo-2-phenylimidazol-1-yl]-1,3-thiazol-4-yl]phenyl]benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2ccc(-c3csc(N4C(=O)/C(=C/c5ccccc5[N+](=O)[O-])N=C4c4ccccc4)n3)cc2)cc1Cl |
| InChI | InChI=1S/C32H22ClN5O6S2/c1-44-29-16-15-24(18-25(29)33)46(42,43)36-23-13-11-20(12-14-23)27-19-45-32(35-27)37-30(21-7-3-2-4-8-21)34-26(31(37)39)17-22-9-5-6-10-28(22)38(40)41/h2-19,36H,1H3/b26-17- |
| InChIKey | RPRLLFYGNZTFHV-ONUIUJJFSA-N |
| XLogP | 7.02 |
| TPSA | 144.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.14 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_five_het_G(10)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|