C33H38N2O8 — CID 54722494
9-tert-butyl-7-[3-[(dimethylamino)methyl]-5-methoxyphenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54722494) has the molecular formula C33H38N2O8 and a molecular weight of 590.67 g/mol. Its IUPAC name is 9-tert-butyl-7-[3-[(dimethylamino)methyl]-5-methoxyphenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | 9-tert-butyl-7-[3-[(dimethylamino)methyl]-5-methoxyphenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722494 |
| Molecular Formula | C33H38N2O8 |
| Molecular Weight | 590.67 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 9-tert-butyl-7-[3-[(dimethylamino)methyl]-5-methoxyphenyl]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | COc1cc(CN(C)C)cc(-c2cc(C(C)(C)C)c(O)c3c2CC2CC4CC(=O)C(C(N)=O)=C(O)C4(O)C(=O)C2=C3O)c1 |
| InChI | InChI=1S/C33H38N2O8/c1-32(2,3)22-13-20(16-7-15(14-35(4)5)8-19(10-16)43-6)21-11-17-9-18-12-23(36)26(31(34)41)30(40)33(18,42)29(39)24(17)28(38)25(21)27(22)37/h7-8,10,13,17-18,37-38,40,42H,9,11-12,14H2,1-6H3,(H2,34,41) |
| InChIKey | YZOMDFJXDAYHAU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 170.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.67 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|