About CID 54753855
CID 54753855 (PubChem CID 54753855) has the molecular formula C30H24Cl2FN5O3S
and a molecular weight of 624.53 g/mol.
Molecular Properties
| Compound Name | CID 54753855 |
| PubChem CID | 54753855 |
| Molecular Formula | C30H24Cl2FN5O3S |
| Molecular Weight | 624.53 g/mol |
| Exact Mass | 623.10 |
| IUPAC Name | — |
| SMILES | CN1CC(c2ccc(F)cc2)C2(SC34ON=C(c5c(Cl)cccc5Cl)N3CCCN4C2=O)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C30H24Cl2FN5O3S/c1-36-16-20(17-10-12-18(33)13-11-17)29(28(36)19-6-2-3-9-23(19)34-26(28)39)27(40)38-15-5-14-37-25(35-41-30(37,38)42-29)24-21(31)7-4-8-22(24)32/h2-4,6-13,20H,5,14-16H2,1H3,(H,34,39) |
| InChIKey | FUQZYCPCLJWJFU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 624.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 54753855 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 54753855?
The IUPAC name of CID 54753855 (CID 54753855) is not available.
What is the SMILES notation for CID 54753855?
The canonical SMILES for CID 54753855 is CN1CC(c2ccc(F)cc2)C2(SC34ON=C(c5c(Cl)cccc5Cl)N3CCCN4C2=O)C12C(=O)Nc1ccccc12.
What is the InChIKey of CID 54753855?
The InChIKey is FUQZYCPCLJWJFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24Cl2FN5O3S/c1-36-16-20(17-10-12-18(33)13-11-17)29(28(36)19-6-2-3-9-23(19)34-26(28)39)27(40)38-15-5-14-37-25(35-41-30(37,38)42-29)24-21(31)7-4-8-22(24)32/h2-4,6-13,20H,5,14-16H2,1H3,(H,34,39).
What are the key properties of CID 54753855?
CID 54753855 has a molecular weight of 624.53 g/mol, XLogP of 5.03, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 54753855 is sourced from PubChem (CID 54753855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).