C30H24Cl2FN5O3S — CID 54753855
CID 54753855 (PubChem CID 54753855) has the molecular formula C30H24Cl2FN5O3S and a molecular weight of 624.53 g/mol.
| Compound Name | CID 54753855 |
|---|---|
| PubChem CID | 54753855 |
| Molecular Formula | C30H24Cl2FN5O3S |
| Molecular Weight | 624.53 g/mol |
| Exact Mass | 623.10 |
| IUPAC Name | — |
| SMILES | CN1CC(c2ccc(F)cc2)C2(SC34ON=C(c5c(Cl)cccc5Cl)N3CCCN4C2=O)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C30H24Cl2FN5O3S/c1-36-16-20(17-10-12-18(33)13-11-17)29(28(36)19-6-2-3-9-23(19)34-26(28)39)27(40)38-15-5-14-37-25(35-41-30(37,38)42-29)24-21(31)7-4-8-22(24)32/h2-4,6-13,20H,5,14-16H2,1H3,(H,34,39) |
| InChIKey | FUQZYCPCLJWJFU-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |