C30H24Cl2N6O5S — CID 54753856
CID 54753856 (PubChem CID 54753856) has the molecular formula C30H24Cl2N6O5S and a molecular weight of 651.53 g/mol.
| Compound Name | CID 54753856 |
|---|---|
| PubChem CID | 54753856 |
| Molecular Formula | C30H24Cl2N6O5S |
| Molecular Weight | 651.53 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | — |
| SMILES | CN1CC(c2ccccc2[N+](=O)[O-])C2(SC34ON=C(c5c(Cl)cccc5Cl)N3CCCN4C2=O)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C30H24Cl2N6O5S/c1-35-16-19(17-8-2-5-13-23(17)38(41)42)29(28(35)18-9-3-4-12-22(18)33-26(28)39)27(40)37-15-7-14-36-25(34-43-30(36,37)44-29)24-20(31)10-6-11-21(24)32/h2-6,8-13,19H,7,14-16H2,1H3,(H,33,39) |
| InChIKey | ZXLAEKOZAPMHQE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|