About CID 54753856
CID 54753856 (PubChem CID 54753856) has the molecular formula C30H24Cl2N6O5S
and a molecular weight of 651.53 g/mol.
Molecular Properties
| Compound Name | CID 54753856 |
| PubChem CID | 54753856 |
| Molecular Formula | C30H24Cl2N6O5S |
| Molecular Weight | 651.53 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | — |
| SMILES | CN1CC(c2ccccc2[N+](=O)[O-])C2(SC34ON=C(c5c(Cl)cccc5Cl)N3CCCN4C2=O)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C30H24Cl2N6O5S/c1-35-16-19(17-8-2-5-13-23(17)38(41)42)29(28(35)18-9-3-4-12-22(18)33-26(28)39)27(40)37-15-7-14-36-25(34-43-30(36,37)44-29)24-20(31)10-6-11-21(24)32/h2-6,8-13,19H,7,14-16H2,1H3,(H,33,39) |
| InChIKey | ZXLAEKOZAPMHQE-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 120.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 651.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 54753856 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 54753856?
The IUPAC name of CID 54753856 (CID 54753856) is not available.
What is the SMILES notation for CID 54753856?
The canonical SMILES for CID 54753856 is CN1CC(c2ccccc2[N+](=O)[O-])C2(SC34ON=C(c5c(Cl)cccc5Cl)N3CCCN4C2=O)C12C(=O)Nc1ccccc12.
What is the InChIKey of CID 54753856?
The InChIKey is ZXLAEKOZAPMHQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H24Cl2N6O5S/c1-35-16-19(17-8-2-5-13-23(17)38(41)42)29(28(35)18-9-3-4-12-22(18)33-26(28)39)27(40)37-15-7-14-36-25(34-43-30(36,37)44-29)24-20(31)10-6-11-21(24)32/h2-6,8-13,19H,7,14-16H2,1H3,(H,33,39).
What are the key properties of CID 54753856?
CID 54753856 has a molecular weight of 651.53 g/mol, XLogP of 4.80, 3 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 54753856 is sourced from PubChem (CID 54753856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).