C23H39NO4Si — CID 54756655
(1R)-1-[(4R,5S)-5-[(1S)-1-(benzylamino)prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol (PubChem CID 54756655) has the molecular formula C23H39NO4Si and a molecular weight of 421.65 g/mol. Its IUPAC name is (1R)-1-[(4R,5S)-5-[(1S)-1-(benzylamino)prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol.
| Compound Name | (1R)-1-[(4R,5S)-5-[(1S)-1-(benzylamino)prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
|---|---|
| PubChem CID | 54756655 |
| Molecular Formula | C23H39NO4Si |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | (1R)-1-[(4R,5S)-5-[(1S)-1-(benzylamino)prop-2-enyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-[tert-butyl(dimethyl)silyl]oxyethanol |
| SMILES | C=C[C@H](NCc1ccccc1)[C@@H]1OC(C)(C)O[C@@H]1[C@H](O)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H39NO4Si/c1-9-18(24-15-17-13-11-10-12-14-17)20-21(28-23(5,6)27-20)19(25)16-26-29(7,8)22(2,3)4/h9-14,18-21,24-25H,1,15-16H2,2-8H3/t18-,19+,20-,21+/m0/s1 |
| InChIKey | OBJYUGBFLOVHDK-JSXRDJHFSA-N |
| XLogP | 4.23 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|