C21H23NO3 — CID 5475868
1-methyl-2-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]-2H-quinoline (PubChem CID 5475868) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 1-methyl-2-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]-2H-quinoline.
| Compound Name | 1-methyl-2-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]-2H-quinoline |
|---|---|
| PubChem CID | 5475868 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1-methyl-2-[(E)-2-(2,4,5-trimethoxyphenyl)ethenyl]-2H-quinoline |
| SMILES | COc1cc(OC)c(OC)cc1/C=C/C1C=Cc2ccccc2N1C |
| InChI | InChI=1S/C21H23NO3/c1-22-17(11-9-15-7-5-6-8-18(15)22)12-10-16-13-20(24-3)21(25-4)14-19(16)23-2/h5-14,17H,1-4H3/b12-10+ |
| InChIKey | DSAZJLAFITVUDS-ZRDIBKRKSA-N |
| XLogP | 4.26 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |