C10H15NO4 — CID 54762866
methyl (7aR)-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate (PubChem CID 54762866) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is methyl (7aR)-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate.
| Compound Name | methyl (7aR)-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
|---|---|
| PubChem CID | 54762866 |
| Molecular Formula | C10H15NO4 |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | methyl (7aR)-3,3-dimethyl-5-oxo-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-6-carboxylate |
| SMILES | COC(=O)C1C[C@@H]2COC(C)(C)N2C1=O |
| InChI | InChI=1S/C10H15NO4/c1-10(2)11-6(5-15-10)4-7(8(11)12)9(13)14-3/h6-7H,4-5H2,1-3H3/t6-,7?/m1/s1 |
| InChIKey | UYLCKTPXVXHHAA-ULUSZKPHSA-N |
| XLogP | 0.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|