About Semidehydroascorbic acid
Semidehydroascorbic acid (PubChem CID 5476732) has the molecular formula C6H7O6
and a molecular weight of 175.12 g/mol.
Molecular Properties
| Compound Name | Semidehydroascorbic acid |
| PubChem CID | 5476732 |
| Molecular Formula | C6H7O6 |
| Molecular Weight | 175.12 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | — |
| SMILES | [O]C1=C(O)C(=O)C(C(O)CO)O1 |
| InChI | InChI=1S/C6H7O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-8,10H,1H2 |
| InChIKey | LHFJOBMTAJJOTB-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.12 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze Semidehydroascorbic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Semidehydroascorbic acid?
The IUPAC name of Semidehydroascorbic acid (CID 5476732) is not available.
What is the SMILES notation for Semidehydroascorbic acid?
The canonical SMILES for Semidehydroascorbic acid is [O]C1=C(O)C(=O)C(C(O)CO)O1.
What is the InChIKey of Semidehydroascorbic acid?
The InChIKey is LHFJOBMTAJJOTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7O6/c7-1-2(8)5-3(9)4(10)6(11)12-5/h2,5,7-8,10H,1H2.
What are the key properties of Semidehydroascorbic acid?
Semidehydroascorbic acid has a molecular weight of 175.12 g/mol, XLogP of -1.53, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for Semidehydroascorbic acid is sourced from PubChem (CID 5476732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).