C14H20BrN3OS — CID 54791437
4-bromo-N-[2-(diethylamino)ethylcarbamothioyl]benzamide (PubChem CID 54791437) has the molecular formula C14H20BrN3OS and a molecular weight of 358.31 g/mol. Its IUPAC name is 4-bromo-N-[2-(diethylamino)ethylcarbamothioyl]benzamide.
| Compound Name | 4-bromo-N-[2-(diethylamino)ethylcarbamothioyl]benzamide |
|---|---|
| PubChem CID | 54791437 |
| Molecular Formula | C14H20BrN3OS |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 4-bromo-N-[2-(diethylamino)ethylcarbamothioyl]benzamide |
| SMILES | CCN(CC)CCNC(=S)NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H20BrN3OS/c1-3-18(4-2)10-9-16-14(20)17-13(19)11-5-7-12(15)8-6-11/h5-8H,3-4,9-10H2,1-2H3,(H2,16,17,19,20) |
| InChIKey | JBZFSLABPWCGRV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|