C14H11N3O — CID 5480628
7-amino-5-phenyl-1H-1,8-naphthyridin-2-one (PubChem CID 5480628) has the molecular formula C14H11N3O and a molecular weight of 237.26 g/mol. Its IUPAC name is 7-amino-5-phenyl-1H-1,8-naphthyridin-2-one.
| Compound Name | 7-amino-5-phenyl-1H-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 5480628 |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 7-amino-5-phenyl-1H-1,8-naphthyridin-2-one |
| SMILES | Nc1cc(-c2ccccc2)c2ccc(=O)[nH]c2n1 |
| InChI | InChI=1S/C14H11N3O/c15-12-8-11(9-4-2-1-3-5-9)10-6-7-13(18)17-14(10)16-12/h1-8H,(H3,15,16,17,18) |
| InChIKey | HUFDWWYZNIWZHT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |