2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid

C13H16O3 — CID 54849806

IUPAC2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid
SMILESC=CCc1ccc(C)c(C)c1OCC(=O)O
InChIInChI=1S/C13H16O3/c1-4-5-11-7-6-9(2)10(3)13(11)16-8-12(14)15/h4,6-7H,1,5,8H2,2-3H3,(H,14,15)
InChIKeyFGNMNIQGZPFAKR-UHFFFAOYSA-N
MW220.27 g/mol
LogP2.50
Rot. Bonds5

About 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid

2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid (PubChem CID 54849806) has the molecular formula C13H16O3 and a molecular weight of 220.27 g/mol. Its IUPAC name is 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid.

Molecular Properties

Compound Name2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid
PubChem CID54849806
Molecular FormulaC13H16O3
Molecular Weight220.27 g/mol
Exact Mass220.11
IUPAC Name2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid
SMILESC=CCc1ccc(C)c(C)c1OCC(=O)O
InChIInChI=1S/C13H16O3/c1-4-5-11-7-6-9(2)10(3)13(11)16-8-12(14)15/h4,6-7H,1,5,8H2,2-3H3,(H,14,15)
InChIKeyFGNMNIQGZPFAKR-UHFFFAOYSA-N
XLogP2.50
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500220.27
LogP ≤ 52.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid?
The IUPAC name of 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid (CID 54849806) is 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid.
What is the SMILES notation for 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid?
The canonical SMILES for 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid is C=CCc1ccc(C)c(C)c1OCC(=O)O.
What is the InChIKey of 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid?
The InChIKey is FGNMNIQGZPFAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O3/c1-4-5-11-7-6-9(2)10(3)13(11)16-8-12(14)15/h4,6-7H,1,5,8H2,2-3H3,(H,14,15).
What are the key properties of 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid?
2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid has a molecular weight of 220.27 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethyl-6-prop-2-enylphenoxy)acetic acid is sourced from PubChem (CID 54849806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).