C21H30N2O5 — CID 54856618
cyclohexyl 2-[1-(2-hydroxy-3-phenoxypropyl)-3-oxopiperazin-2-yl]acetate (PubChem CID 54856618) has the molecular formula C21H30N2O5 and a molecular weight of 390.48 g/mol. Its IUPAC name is cyclohexyl 2-[1-(2-hydroxy-3-phenoxypropyl)-3-oxopiperazin-2-yl]acetate.
| Compound Name | cyclohexyl 2-[1-(2-hydroxy-3-phenoxypropyl)-3-oxopiperazin-2-yl]acetate |
|---|---|
| PubChem CID | 54856618 |
| Molecular Formula | C21H30N2O5 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | cyclohexyl 2-[1-(2-hydroxy-3-phenoxypropyl)-3-oxopiperazin-2-yl]acetate |
| SMILES | O=C(CC1C(=O)NCCN1CC(O)COc1ccccc1)OC1CCCCC1 |
| InChI | InChI=1S/C21H30N2O5/c24-16(15-27-17-7-3-1-4-8-17)14-23-12-11-22-21(26)19(23)13-20(25)28-18-9-5-2-6-10-18/h1,3-4,7-8,16,18-19,24H,2,5-6,9-15H2,(H,22,26) |
| InChIKey | DVTSPNVONUYIQN-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |