C27H25ClN4O4 — CID 54858328
N-[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 54858328) has the molecular formula C27H25ClN4O4 and a molecular weight of 504.97 g/mol. Its IUPAC name is N-[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 54858328 |
| Molecular Formula | C27H25ClN4O4 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | N-[4-[(5-chloro-1,3-benzoxazol-2-yl)methyl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | CC1CCN(c2ccc(C(=O)Nc3ccc(Cc4nc5cc(Cl)ccc5o4)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H25ClN4O4/c1-17-10-12-31(13-11-17)23-8-4-19(15-24(23)32(34)35)27(33)29-21-6-2-18(3-7-21)14-26-30-22-16-20(28)5-9-25(22)36-26/h2-9,15-17H,10-14H2,1H3,(H,29,33) |
| InChIKey | BJWALZQUVICGEN-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|