C27H24Cl2N4O4 — CID 54858329
N-[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide (PubChem CID 54858329) has the molecular formula C27H24Cl2N4O4 and a molecular weight of 539.42 g/mol. Its IUPAC name is N-[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide.
| Compound Name | N-[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 54858329 |
| Molecular Formula | C27H24Cl2N4O4 |
| Molecular Weight | 539.42 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | N-[4-[(5,7-dichloro-1,3-benzoxazol-2-yl)methyl]phenyl]-4-(4-methylpiperidin-1-yl)-3-nitrobenzamide |
| SMILES | CC1CCN(c2ccc(C(=O)Nc3ccc(Cc4nc5cc(Cl)cc(Cl)c5o4)cc3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C27H24Cl2N4O4/c1-16-8-10-32(11-9-16)23-7-4-18(13-24(23)33(35)36)27(34)30-20-5-2-17(3-6-20)12-25-31-22-15-19(28)14-21(29)26(22)37-25/h2-7,13-16H,8-12H2,1H3,(H,30,34) |
| InChIKey | HIEXRMVBCZSMLA-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.42 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|