C8H9Cl3N2O2 — CID 5493104
2-(3,4-dichlorophenyl)-N',2-dihydroxyethanimidamide;hydrochloride (PubChem CID 5493104) has the molecular formula C8H9Cl3N2O2 and a molecular weight of 271.53 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-N',2-dihydroxyethanimidamide;hydrochloride.
| Compound Name | 2-(3,4-dichlorophenyl)-N',2-dihydroxyethanimidamide;hydrochloride |
|---|---|
| PubChem CID | 5493104 |
| Molecular Formula | C8H9Cl3N2O2 |
| Molecular Weight | 271.53 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-N',2-dihydroxyethanimidamide;hydrochloride |
| SMILES | Cl.N/C(=N/O)C(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2N2O2.ClH/c9-5-2-1-4(3-6(5)10)7(13)8(11)12-14;/h1-3,7,13-14H,(H2,11,12);1H |
| InChIKey | MBAOGTJBCFRWTK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|