C13H24N2O2 — CID 54967882
butyl 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)acetate (PubChem CID 54967882) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is butyl 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)acetate.
| Compound Name | butyl 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)acetate |
|---|---|
| PubChem CID | 54967882 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | butyl 2-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)acetate |
| SMILES | CCCCOC(=O)CNC1CCN2CCCC12 |
| InChI | InChI=1S/C13H24N2O2/c1-2-3-9-17-13(16)10-14-11-6-8-15-7-4-5-12(11)15/h11-12,14H,2-10H2,1H3 |
| InChIKey | RHZCNHBUTKUHRC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|