C14H23NO3 — CID 54976992
oxolan-3-ylmethyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate (PubChem CID 54976992) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is oxolan-3-ylmethyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate.
| Compound Name | oxolan-3-ylmethyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 54976992 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | oxolan-3-ylmethyl 2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxylate |
| SMILES | O=C(OCC1CCOC1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C14H23NO3/c16-14(18-9-10-5-6-17-8-10)13-7-11-3-1-2-4-12(11)15-13/h10-13,15H,1-9H2 |
| InChIKey | SJXRYBIKJQCOAY-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |