C11H11F3N4 — CID 54982328
1-N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 54982328) has the molecular formula C11H11F3N4 and a molecular weight of 256.23 g/mol. Its IUPAC name is 1-N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 54982328 |
| Molecular Formula | C11H11F3N4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | 1-N-(1H-pyrazol-4-ylmethyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2cn[nH]c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H11F3N4/c12-11(13,14)9-3-8(15)1-2-10(9)16-4-7-5-17-18-6-7/h1-3,5-6,16H,4,15H2,(H,17,18) |
| InChIKey | KHUGLKWROCHJJI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|