C10H10ClF3N2O2S — CID 54983763
6-chloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide (PubChem CID 54983763) has the molecular formula C10H10ClF3N2O2S and a molecular weight of 314.72 g/mol. Its IUPAC name is 6-chloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide.
| Compound Name | 6-chloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 54983763 |
| Molecular Formula | C10H10ClF3N2O2S |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 314.01 |
| IUPAC Name | 6-chloro-N-cyclopropyl-N-(2,2,2-trifluoroethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(c1ccc(Cl)nc1)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H10ClF3N2O2S/c11-9-4-3-8(5-15-9)19(17,18)16(7-1-2-7)6-10(12,13)14/h3-5,7H,1-2,6H2 |
| InChIKey | CCQCGOCLYUSIEY-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|