C9H19F3N2O2S — CID 55010472
4-amino-N-propyl-N-(2,2,2-trifluoroethyl)butane-1-sulfonamide (PubChem CID 55010472) has the molecular formula C9H19F3N2O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is 4-amino-N-propyl-N-(2,2,2-trifluoroethyl)butane-1-sulfonamide.
| Compound Name | 4-amino-N-propyl-N-(2,2,2-trifluoroethyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 55010472 |
| Molecular Formula | C9H19F3N2O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-amino-N-propyl-N-(2,2,2-trifluoroethyl)butane-1-sulfonamide |
| SMILES | CCCN(CC(F)(F)F)S(=O)(=O)CCCCN |
| InChI | InChI=1S/C9H19F3N2O2S/c1-2-6-14(8-9(10,11)12)17(15,16)7-4-3-5-13/h2-8,13H2,1H3 |
| InChIKey | ZMQMNNUNTANXGW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|