C13H18N2O4 — CID 55012394
2-[[6-(ethylaminomethyl)-1,3-benzodioxol-5-yl]oxy]propanamide (PubChem CID 55012394) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[[6-(ethylaminomethyl)-1,3-benzodioxol-5-yl]oxy]propanamide.
| Compound Name | 2-[[6-(ethylaminomethyl)-1,3-benzodioxol-5-yl]oxy]propanamide |
|---|---|
| PubChem CID | 55012394 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 2-[[6-(ethylaminomethyl)-1,3-benzodioxol-5-yl]oxy]propanamide |
| SMILES | CCNCc1cc2c(cc1OC(C)C(N)=O)OCO2 |
| InChI | InChI=1S/C13H18N2O4/c1-3-15-6-9-4-11-12(18-7-17-11)5-10(9)19-8(2)13(14)16/h4-5,8,15H,3,6-7H2,1-2H3,(H2,14,16) |
| InChIKey | PQMYNHBNGQSTGX-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |