C9H6F6N2O4 — CID 550419
3-methyl-1,4-bis(2,2,2-trifluoroacetyl)piperazine-2,5-dione (PubChem CID 550419) has the molecular formula C9H6F6N2O4 and a molecular weight of 320.15 g/mol. Its IUPAC name is 3-methyl-1,4-bis(2,2,2-trifluoroacetyl)piperazine-2,5-dione.
| Compound Name | 3-methyl-1,4-bis(2,2,2-trifluoroacetyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 550419 |
| Molecular Formula | C9H6F6N2O4 |
| Molecular Weight | 320.15 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 3-methyl-1,4-bis(2,2,2-trifluoroacetyl)piperazine-2,5-dione |
| SMILES | CC1C(=O)N(C(=O)C(F)(F)F)CC(=O)N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H6F6N2O4/c1-3-5(19)16(6(20)8(10,11)12)2-4(18)17(3)7(21)9(13,14)15/h3H,2H2,1H3 |
| InChIKey | LKTABFHVERHIMP-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.15 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |