C10H9ClN4S2 — CID 55079053
2-chloro-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzenecarboximidamide (PubChem CID 55079053) has the molecular formula C10H9ClN4S2 and a molecular weight of 284.80 g/mol. Its IUPAC name is 2-chloro-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzenecarboximidamide.
| Compound Name | 2-chloro-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 55079053 |
| Molecular Formula | C10H9ClN4S2 |
| Molecular Weight | 284.80 g/mol |
| Exact Mass | 284.00 |
| IUPAC Name | 2-chloro-6-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1c(Cl)cccc1Sc1nnc(C)s1 |
| InChI | InChI=1S/C10H9ClN4S2/c1-5-14-15-10(16-5)17-7-4-2-3-6(11)8(7)9(12)13/h2-4H,1H3,(H3,12,13) |
| InChIKey | DPOWIZFIQAAFPS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.80 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|