C10H15BrN4O2S — CID 55155295
2-[[2-amino-1-(4-bromothiophen-2-yl)ethyl]-(2-amino-2-oxoethyl)amino]acetamide (PubChem CID 55155295) has the molecular formula C10H15BrN4O2S and a molecular weight of 335.23 g/mol. Its IUPAC name is 2-[[2-amino-1-(4-bromothiophen-2-yl)ethyl]-(2-amino-2-oxoethyl)amino]acetamide.
| Compound Name | 2-[[2-amino-1-(4-bromothiophen-2-yl)ethyl]-(2-amino-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 55155295 |
| Molecular Formula | C10H15BrN4O2S |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 2-[[2-amino-1-(4-bromothiophen-2-yl)ethyl]-(2-amino-2-oxoethyl)amino]acetamide |
| SMILES | NCC(c1cc(Br)cs1)N(CC(N)=O)CC(N)=O |
| InChI | InChI=1S/C10H15BrN4O2S/c11-6-1-8(18-5-6)7(2-12)15(3-9(13)16)4-10(14)17/h1,5,7H,2-4,12H2,(H2,13,16)(H2,14,17) |
| InChIKey | IAZGBDKBXUSZTK-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |