C10H15N5O — CID 55210277
N-butyl-2-(3-cyano-1,2,4-triazol-1-yl)propanamide (PubChem CID 55210277) has the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. Its IUPAC name is N-butyl-2-(3-cyano-1,2,4-triazol-1-yl)propanamide.
| Compound Name | N-butyl-2-(3-cyano-1,2,4-triazol-1-yl)propanamide |
|---|---|
| PubChem CID | 55210277 |
| Molecular Formula | C10H15N5O |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | N-butyl-2-(3-cyano-1,2,4-triazol-1-yl)propanamide |
| SMILES | CCCCNC(=O)C(C)n1cnc(C#N)n1 |
| InChI | InChI=1S/C10H15N5O/c1-3-4-5-12-10(16)8(2)15-7-13-9(6-11)14-15/h7-8H,3-5H2,1-2H3,(H,12,16) |
| InChIKey | LASSFEKLZWDFFE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|