C10H8FNO2 — CID 55255072
[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methanol (PubChem CID 55255072) has the molecular formula C10H8FNO2 and a molecular weight of 193.18 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methanol.
| Compound Name | [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 55255072 |
| Molecular Formula | C10H8FNO2 |
| Molecular Weight | 193.18 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | [2-(2-fluorophenyl)-1,3-oxazol-4-yl]methanol |
| SMILES | OCc1coc(-c2ccccc2F)n1 |
| InChI | InChI=1S/C10H8FNO2/c11-9-4-2-1-3-8(9)10-12-7(5-13)6-14-10/h1-4,6,13H,5H2 |
| InChIKey | SSHSJSFKUJWMKY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |