C17H12FN3O — CID 166339061
4-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methylamino]benzonitrile (PubChem CID 166339061) has the molecular formula C17H12FN3O and a molecular weight of 293.30 g/mol. Its IUPAC name is 4-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methylamino]benzonitrile.
| Compound Name | 4-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methylamino]benzonitrile |
|---|---|
| PubChem CID | 166339061 |
| Molecular Formula | C17H12FN3O |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 4-[[2-(2-fluorophenyl)-1,3-oxazol-4-yl]methylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCc2coc(-c3ccccc3F)n2)cc1 |
| InChI | InChI=1S/C17H12FN3O/c18-16-4-2-1-3-15(16)17-21-14(11-22-17)10-20-13-7-5-12(9-19)6-8-13/h1-8,11,20H,10H2 |
| InChIKey | JZWAHAGCTHTQBZ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |