C9H10O4 — CID 55267815
3-(4,5-dimethylfuran-2-yl)-3-oxopropanoic acid (PubChem CID 55267815) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is 3-(4,5-dimethylfuran-2-yl)-3-oxopropanoic acid.
| Compound Name | 3-(4,5-dimethylfuran-2-yl)-3-oxopropanoic acid |
|---|---|
| PubChem CID | 55267815 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 3-(4,5-dimethylfuran-2-yl)-3-oxopropanoic acid |
| SMILES | Cc1cc(C(=O)CC(=O)O)oc1C |
| InChI | InChI=1S/C9H10O4/c1-5-3-8(13-6(5)2)7(10)4-9(11)12/h3H,4H2,1-2H3,(H,11,12) |
| InChIKey | XILMIYBNUTVDKL-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|