C17H42O5Si4 — CID 552774
trimethylsilyl 2,4-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)butanoate (PubChem CID 552774) has the molecular formula C17H42O5Si4 and a molecular weight of 438.86 g/mol. Its IUPAC name is trimethylsilyl 2,4-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)butanoate.
| Compound Name | trimethylsilyl 2,4-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)butanoate |
|---|---|
| PubChem CID | 552774 |
| Molecular Formula | C17H42O5Si4 |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | trimethylsilyl 2,4-bis(trimethylsilyloxy)-2-(trimethylsilyloxymethyl)butanoate |
| SMILES | C[Si](C)(C)OCCC(CO[Si](C)(C)C)(O[Si](C)(C)C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H42O5Si4/c1-23(2,3)19-14-13-17(22-26(10,11)12,15-20-24(4,5)6)16(18)21-25(7,8)9/h13-15H2,1-12H3 |
| InChIKey | FKAKIAINQCBRDM-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|