C9H17N — CID 55284909
(1S,2S,3R,5S)-3-propylbicyclo[3.1.0]hexan-2-amine (PubChem CID 55284909) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (1S,2S,3R,5S)-3-propylbicyclo[3.1.0]hexan-2-amine.
| Compound Name | (1S,2S,3R,5S)-3-propylbicyclo[3.1.0]hexan-2-amine |
|---|---|
| PubChem CID | 55284909 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (1S,2S,3R,5S)-3-propylbicyclo[3.1.0]hexan-2-amine |
| SMILES | CCC[C@@H]1C[C@@H]2C[C@@H]2[C@H]1N |
| InChI | InChI=1S/C9H17N/c1-2-3-6-4-7-5-8(7)9(6)10/h6-9H,2-5,10H2,1H3/t6-,7-,8+,9+/m1/s1 |
| InChIKey | AYDXJHFBHSVZQC-HXFLIBJXSA-N |
| XLogP | 1.77 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |