C5H8N2OS — CID 55285026
5-methyl-4-methylsulfanyl-1,2-oxazol-3-amine (PubChem CID 55285026) has the molecular formula C5H8N2OS and a molecular weight of 144.20 g/mol. Its IUPAC name is 5-methyl-4-methylsulfanyl-1,2-oxazol-3-amine.
| Compound Name | 5-methyl-4-methylsulfanyl-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 55285026 |
| Molecular Formula | C5H8N2OS |
| Molecular Weight | 144.20 g/mol |
| Exact Mass | 144.04 |
| IUPAC Name | 5-methyl-4-methylsulfanyl-1,2-oxazol-3-amine |
| SMILES | CSc1c(N)noc1C |
| InChI | InChI=1S/C5H8N2OS/c1-3-4(9-2)5(6)7-8-3/h1-2H3,(H2,6,7) |
| InChIKey | KAXHZFXZBKPVSW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |