About 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol
2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol (PubChem CID 129320159) has the molecular formula C6H10N2O2
and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol |
| PubChem CID | 129320159 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol |
| SMILES | Cc1onc(N)c1CCO |
| InChI | InChI=1S/C6H10N2O2/c1-4-5(2-3-9)6(7)8-10-4/h9H,2-3H2,1H3,(H2,7,8) |
| InChIKey | KURBPJXDTBQERL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol?
The IUPAC name of 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol (CID 129320159) is 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol.
What is the SMILES notation for 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol?
The canonical SMILES for 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol is Cc1onc(N)c1CCO.
What is the InChIKey of 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol?
The InChIKey is KURBPJXDTBQERL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O2/c1-4-5(2-3-9)6(7)8-10-4/h9H,2-3H2,1H3,(H2,7,8).
What are the key properties of 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol?
2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol has a molecular weight of 142.16 g/mol, XLogP of 0.10, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol is sourced from PubChem (CID 129320159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).