C6H10N2O2 — CID 129320159
2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol (PubChem CID 129320159) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol.
| Compound Name | 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol |
|---|---|
| PubChem CID | 129320159 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | 2-(3-amino-5-methyl-1,2-oxazol-4-yl)ethanol |
| SMILES | Cc1onc(N)c1CCO |
| InChI | InChI=1S/C6H10N2O2/c1-4-5(2-3-9)6(7)8-10-4/h9H,2-3H2,1H3,(H2,7,8) |
| InChIKey | KURBPJXDTBQERL-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |