About 1-ethoxyethylcyanamide
1-ethoxyethylcyanamide (PubChem CID 55286094) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is 1-ethoxyethylcyanamide.
Molecular Properties
| Compound Name | 1-ethoxyethylcyanamide |
| PubChem CID | 55286094 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | 1-ethoxyethylcyanamide |
| SMILES | CCOC(C)NC#N |
| InChI | InChI=1S/C5H10N2O/c1-3-8-5(2)7-4-6/h5,7H,3H2,1-2H3 |
| InChIKey | ZJEQGHGASIUJGI-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxyethylcyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxyethylcyanamide?
The IUPAC name of 1-ethoxyethylcyanamide (CID 55286094) is 1-ethoxyethylcyanamide.
What is the SMILES notation for 1-ethoxyethylcyanamide?
The canonical SMILES for 1-ethoxyethylcyanamide is CCOC(C)NC#N.
What is the InChIKey of 1-ethoxyethylcyanamide?
The InChIKey is ZJEQGHGASIUJGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O/c1-3-8-5(2)7-4-6/h5,7H,3H2,1-2H3.
What are the key properties of 1-ethoxyethylcyanamide?
1-ethoxyethylcyanamide has a molecular weight of 114.15 g/mol, XLogP of 0.44, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxyethylcyanamide is sourced from PubChem (CID 55286094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).