2-[carbamoyl(methoxy)amino]acetic acid

C4H8N2O4 — CID 55288680

IUPAC2-[carbamoyl(methoxy)amino]acetic acid
SMILESCON(CC(=O)O)C(N)=O
InChIInChI=1S/C4H8N2O4/c1-10-6(4(5)9)2-3(7)8/h2H2,1H3,(H2,5,9)(H,7,8)
InChIKeyMQQUUTUFUHTLTE-UHFFFAOYSA-N
MW148.12 g/mol
LogP-0.99
Rot. Bonds3

About 2-[carbamoyl(methoxy)amino]acetic acid

2-[carbamoyl(methoxy)amino]acetic acid (PubChem CID 55288680) has the molecular formula C4H8N2O4 and a molecular weight of 148.12 g/mol. Its IUPAC name is 2-[carbamoyl(methoxy)amino]acetic acid.

Molecular Properties

Compound Name2-[carbamoyl(methoxy)amino]acetic acid
PubChem CID55288680
Molecular FormulaC4H8N2O4
Molecular Weight148.12 g/mol
Exact Mass148.05
IUPAC Name2-[carbamoyl(methoxy)amino]acetic acid
SMILESCON(CC(=O)O)C(N)=O
InChIInChI=1S/C4H8N2O4/c1-10-6(4(5)9)2-3(7)8/h2H2,1H3,(H2,5,9)(H,7,8)
InChIKeyMQQUUTUFUHTLTE-UHFFFAOYSA-N
XLogP-0.99
TPSA92.86 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500148.12
LogP ≤ 5-0.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-[carbamoyl(methoxy)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(dimethoxyamino)acetic acid
CID 156905250
2-[ethyl(methoxy)amino]acetic acid
CID 87131030
2-[(2-methylpropan-2-yl)oxy-propanoylamino]acetic acid
CID 87737931
2-[carboxymethyl-[2-(methoxyamino)-2-oxoethyl]amino]acetic acid;ethane
CID 153337415
2-[(2-amino-2-oxoethyl)-(3-methoxypropanoyl)amino]acetic acid
CID 107433829
2-[carboxymethyl(dimethylphosphanyl)amino]acetic acid
CID 20643327
2-[2-[bis(carboxymethyl)amino]ethyl-(carboxymethyl)amino]acetic acid;carbamic acid
CID 146494251
amino N-ethyl-N-methoxycarbamate
CID 91118024
1,1-diaminourea;ethane
CID 174870185
2-[bis(carboxymethyl)amino]acetic acid
CID 22440005
2-[amino(propan-2-yl)amino]acetic acid
CID 10887948
2-[bis(carboxymethyl)amino]acetic acid;N,N-dimethylmethanamine
CID 88838366

Frequently Asked Questions

What is the IUPAC name of 2-[carbamoyl(methoxy)amino]acetic acid?
The IUPAC name of 2-[carbamoyl(methoxy)amino]acetic acid (CID 55288680) is 2-[carbamoyl(methoxy)amino]acetic acid.
What is the SMILES notation for 2-[carbamoyl(methoxy)amino]acetic acid?
The canonical SMILES for 2-[carbamoyl(methoxy)amino]acetic acid is CON(CC(=O)O)C(N)=O.
What is the InChIKey of 2-[carbamoyl(methoxy)amino]acetic acid?
The InChIKey is MQQUUTUFUHTLTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O4/c1-10-6(4(5)9)2-3(7)8/h2H2,1H3,(H2,5,9)(H,7,8).
What are the key properties of 2-[carbamoyl(methoxy)amino]acetic acid?
2-[carbamoyl(methoxy)amino]acetic acid has a molecular weight of 148.12 g/mol, XLogP of -0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[carbamoyl(methoxy)amino]acetic acid is sourced from PubChem (CID 55288680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).