2-(dimethoxyamino)acetic acid

C4H9NO4 — CID 156905250

IUPAC2-(dimethoxyamino)acetic acid
SMILESCON(CC(=O)O)OC
InChIInChI=1S/C4H9NO4/c1-8-5(9-2)3-4(6)7/h3H2,1-2H3,(H,6,7)
InChIKeyUGNDXSGINRHORS-UHFFFAOYSA-N
MW135.12 g/mol
LogP-0.50
Rot. Bonds4

About 2-(dimethoxyamino)acetic acid

2-(dimethoxyamino)acetic acid (PubChem CID 156905250) has the molecular formula C4H9NO4 and a molecular weight of 135.12 g/mol. Its IUPAC name is 2-(dimethoxyamino)acetic acid.

Molecular Properties

Compound Name2-(dimethoxyamino)acetic acid
PubChem CID156905250
Molecular FormulaC4H9NO4
Molecular Weight135.12 g/mol
Exact Mass135.05
IUPAC Name2-(dimethoxyamino)acetic acid
SMILESCON(CC(=O)O)OC
InChIInChI=1S/C4H9NO4/c1-8-5(9-2)3-4(6)7/h3H2,1-2H3,(H,6,7)
InChIKeyUGNDXSGINRHORS-UHFFFAOYSA-N
XLogP-0.50
TPSA59.00 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500135.12
LogP ≤ 5-0.50
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 2-(dimethoxyamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(dimethoxyamino)acetic acid?
The IUPAC name of 2-(dimethoxyamino)acetic acid (CID 156905250) is 2-(dimethoxyamino)acetic acid.
What is the SMILES notation for 2-(dimethoxyamino)acetic acid?
The canonical SMILES for 2-(dimethoxyamino)acetic acid is CON(CC(=O)O)OC.
What is the InChIKey of 2-(dimethoxyamino)acetic acid?
The InChIKey is UGNDXSGINRHORS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO4/c1-8-5(9-2)3-4(6)7/h3H2,1-2H3,(H,6,7).
What are the key properties of 2-(dimethoxyamino)acetic acid?
2-(dimethoxyamino)acetic acid has a molecular weight of 135.12 g/mol, XLogP of -0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethoxyamino)acetic acid is sourced from PubChem (CID 156905250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).