C23H25N3O5S — CID 55329061
ethyl 2-[(1-butyl-6-oxopyridazine-3-carbonyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate (PubChem CID 55329061) has the molecular formula C23H25N3O5S and a molecular weight of 455.54 g/mol. Its IUPAC name is ethyl 2-[(1-butyl-6-oxopyridazine-3-carbonyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[(1-butyl-6-oxopyridazine-3-carbonyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 55329061 |
| Molecular Formula | C23H25N3O5S |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | ethyl 2-[(1-butyl-6-oxopyridazine-3-carbonyl)amino]-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| SMILES | CCCCn1nc(C(=O)Nc2scc(-c3ccc(OC)cc3)c2C(=O)OCC)ccc1=O |
| InChI | InChI=1S/C23H25N3O5S/c1-4-6-13-26-19(27)12-11-18(25-26)21(28)24-22-20(23(29)31-5-2)17(14-32-22)15-7-9-16(30-3)10-8-15/h7-12,14H,4-6,13H2,1-3H3,(H,24,28) |
| InChIKey | NDABIVSMLNRFCT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|